1,2-DIBROMO-1,2-DIPHENYLETHANE manufacturers
|
| | 1,2-DIBROMO-1,2-DIPHENYLETHANE Basic information |
| Product Name: | 1,2-DIBROMO-1,2-DIPHENYLETHANE | | Synonyms: | STILBENE DIBROMIDE;TIMTEC-BB SBB008899;1,2-DIBROMO-1,2-DIPHENYLETHANE;A,A'-DIBROMOBIBENZYL;Dibromodiphenylethane;LABOTEST-BB LT00159599;MESO-1,2-DIBROMO-1,2-DIPHENYLETHANE;MESO-STILBENE DIBROMIDE | | CAS: | 13440-24-9 | | MF: | C14H12Br2 | | MW: | 340.05 | | EINECS: | 635-052-9 | | Product Categories: | | | Mol File: | 13440-24-9.mol |  |
| | 1,2-DIBROMO-1,2-DIPHENYLETHANE Chemical Properties |
| Melting point | 241 °C (dec.)(lit.) | | Boiling point | 323.8±37.0 °C(Predicted) | | density | 1.613±0.06 g/cm3(Predicted) | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | Insoluble in water. | | BRN | 2050820 | | InChI | 1S/C14H12Br2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+ | | InChIKey | GKESIQQTGWVOLH-OKILXGFUSA-N | | SMILES | Br[C@H]([C@H](Br)c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 13440-24-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8/PG 3 | | WGK Germany | 3 | | HS Code | 2903.99.8001 | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| | 1,2-DIBROMO-1,2-DIPHENYLETHANE Usage And Synthesis |
| Uses | meso-1,2-Dibromo-1,2-diphenylethane is used to study the reaction of ± and meso-SBr2 with 9-substituted fluorenide ions in dimethyl sulfoxide. It undergoes electrochemical dehalogenation in acetonitrile. |
| | 1,2-DIBROMO-1,2-DIPHENYLETHANE Preparation Products And Raw materials |
|