- Wright's stain
-
-
2026-07-06
- CAS:68988-92-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | Wright's stain Basic information |
| Product Name: | Wright's stain | | Synonyms: | WRIGHT'S STAIN FOR MICROSCOPY;WrightStain,highpurity;Wright Stain, high purity biological stain, pure;Wright's Staine;Wrights Stain Certified;Wright's Stain [for Microscopy and Bacteriology];Polychrome methylene blue, eosinate;Wright's blood staining | | CAS: | 68988-92-1 | | MF: | C36H27Br4N3O5S+2 | | MW: | 933.29768 | | EINECS: | 273-541-5 | | Product Categories: | | | Mol File: | 68988-92-1.mol |  |
| | Wright's stain Chemical Properties |
| Melting point | -98°C | | Boiling point | 65°C | | density | 0.8 | | vapor density | 3.17 (vs air) | | vapor pressure | 97.68 mm of Hg (@ 20°C) | | refractive index | 1.52-1.522 | | Fp | 11°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | methanol: soluble10mg/10 mL | | form | Solid | | color | Dark green | | Odor | Dark blue | | explosive limit | 6-36.50% | | Water Solubility | Easily soluble in cold water | | λmax | 520-530 nm (Eosin) 645-655 nm (Azure) | | Major Application | diagnostic assay manufacturing hematology histology | | InChIKey | AXIKDPDWFVPGOD-UHFFFAOYSA-O | | SMILES | [s]5c6c(nc7c5cc(cc7)N(C)C)cc[c](c6)=[N+](C)C.Brc1c2[o+]c3c(c(c2cc(c1O)Br)c4c(cccc4)C(=O)O)cc(c(c3Br)O)Br | | EPA Substance Registry System | Stains, biological, Wright's (68988-92-1) |
| | Wright's stain Usage And Synthesis |
| Chemical Properties | blue with red shades to dark purple solution | | Uses | Wright Stain (cas# 68988-92-1) is a compound useful in organic synthesis. | | Definition | Wright's stain is a complex compound from eosin and an oxidized and partly demethylated methylene blue. Identification or analysis is unknown. |
| | Wright's stain Preparation Products And Raw materials |
|