- H-DAP(BOC)-OME HCL
-
- $1.00 / 1KG
-
2019-07-06
- CAS:114559-25-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200kg
|
| | H-DAP(BOC)-OME HCL Basic information |
| Product Name: | H-DAP(BOC)-OME HCL | | Synonyms: | H-DAP(BOC)-OME HCL;H-Dapa(Boc)-Ome.HCl;H-L-Dap(Boc)-OMe*HCl;H-Dapa(Boc);Dap (Boc)-OMe·HCl;Nβ-Boc-L-2,3-diaminopropionic acid methyl ester hydrochloride≥ 99% (HPLC);N-BETA-BOC-L-2,3-DIAMINOPROPIONIC ACID METHYL ESTER HYDROCHLORIDE;N-BETA-T-BUTOXYCARBONYL-L-ALPHA,BETA-DIAMINOPROPIONIC ACID-METHYL ESTER HYDROCHLORIDE | | CAS: | 114559-25-0 | | MF: | C9H19ClN2O4 | | MW: | 254.71 | | EINECS: | | | Product Categories: | amino acid;Unusual Amino Acids;amino acids;amino | | Mol File: | 114559-25-0.mol |  |
| | H-DAP(BOC)-OME HCL Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | solid | | color | White | | InChI | 1S/C9H18N2O4.ClH/c1-9(2,3)15-8(13)11-5-6(10)7(12)14-4;/h6H,5,10H2,1-4H3,(H,11,13);1H/t6-;/m0./s1 | | InChIKey | GDJLJNFNXINTHS-RGMNGODLSA-N | | SMILES | Cl.COC(=O)[C@@H](N)CNC(=O)OC(C)(C)C |
| WGK Germany | WGK 3 | | HS Code | 3504009000 | | Storage Class | 11 - Combustible Solids |
| | H-DAP(BOC)-OME HCL Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Nbeta-Boc-L-2,3-diaminopropionic Acid Methyl Ester Hydrochloride |
| | H-DAP(BOC)-OME HCL Preparation Products And Raw materials |
|