| Company Name: |
xinguokeji Gold |
| Tel: |
13120711461 |
| Email: |
363372932@qq.com |
|
| | Cyclo(-Ala-Ala) Basic information |
| Product Name: | Cyclo(-Ala-Ala) | | Synonyms: | ALA-ALA DIKETOPIPERAZIN;L-cis-3,6-Dimethyl-2,5-piperazinedione;cyclo(alanylalanyl);(3S,6S)-3,6-dimethylpiperazine-2,5-quinone;2,5-Piperazinedione,3,6-dimethyl-, (3S,6S)-;Cyclo (L-Ala-L-ala)≥ 99% (HPLC);CYCLO (L-ALA-L-ALA);CYCLO(L-ALA-ALA) | | CAS: | 5845-61-4 | | MF: | C6H10N2O2 | | MW: | 142.16 | | EINECS: | | | Product Categories: | | | Mol File: | 5845-61-4.mol |  |
| | Cyclo(-Ala-Ala) Chemical Properties |
| Melting point | 282-282.5 °C | | Boiling point | 453.0±38.0 °C(Predicted) | | density | 1.081±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 12.97±0.60(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H10N2O2/c1-3-5(9)8-4(2)6(10)7-3/h3-4H,1-2H3,(H,7,10)(H,8,9)/t3-,4-/m0/s1 | | InChIKey | WWISPHBAYBECQZ-IMJSIDKUSA-N | | SMILES | N1[C@@H](C)C(=O)N[C@@H](C)C1=O |
| | Cyclo(-Ala-Ala) Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Cyclo(L-Ala-L-ala) |
| | Cyclo(-Ala-Ala) Preparation Products And Raw materials |
|