| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Benzyl-3,6-dioxo-2-piperazineacetic acid Basic information |
| Product Name: | 5-Benzyl-3,6-dioxo-2-piperazineacetic acid | | Synonyms: | Aspartame Impurity 1（Aspartame EP Impurity A）;2-[(2S,5S)-3,6-dioxo-5-(phenylmethyl)piperazin-2-yl]acetic acid;2-[(2S,5S)-3,6-dioxo-5-(phenylmethyl)piperazin-2-yl]ethanoic acid;2-[(2S,5S)-5-(benzyl)-3,6-diketo-piperazin-2-yl]acetic acid;(2S,5S)-5-Benzyl-3,6-dioxo-2-piperazineacetic Acid;Aspartame Related Compound A (25 mg) (5-Benzyl-3,6-dioxo-2-piperazineacetic Acid);(2S,5S)-3,6-Dioxo-5-(phenylMethyl)-2-piperazineacetic Acid;(2S-cis)-3,6-Dioxo-5-(phenylMethyl)-2-piperazineacetic Acid | | CAS: | 5262-10-2 | | MF: | C13H14N2O4 | | MW: | 262.26 | | EINECS: | 226-075-1 | | Product Categories: | Aromatics;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Chiral Building Blocks;Heterocyclic Building Blocks;Piperazines | | Mol File: | 5262-10-2.mol |  |
| | 5-Benzyl-3,6-dioxo-2-piperazineacetic acid Chemical Properties |
| Melting point | 270-272 °C(lit.) | | Boiling point | 667.4±40.0 °C(Predicted) | | density | 1.298±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetic Acid (Slightly, Heated, Sonicated), DMSO (Slightly) | | form | powder | | pka | 4.02±0.10(Predicted) | | color | White to Off-White | | Optical Rotation | [α]20/D 9.0°, c = 0.9 in acetic acid | | Major Application | cleaning products
cosmetics
food and beverages
personal care | | InChI | InChI=1S/C13H14N2O4/c16-11(17)7-10-13(19)14-9(12(18)15-10)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,14,19)(H,15,18)(H,16,17)/t9-,10-/m0/s1 | | InChIKey | VNHJXYUDIBQDDX-UWVGGRQHSA-N | | SMILES | N1C(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@@H]1CC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933599550 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Benzyl-3,6-dioxo-2-piperazineacetic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | (2S,5S)-5-Benzyl-3,6-dioxo-2-piperazineacetic Acid (Aspartame EP Impurity A) is the diketopiperazine impurity of the sweetening agent Aspartame (A790015). It is also found in in processed cocoa powder. | | General Description | (2S-cis)-(-)-5-Benzyl-3,6-dioxo-2-piperazineacetic acid is a piperazine scaffold that can be used to construct biologically active compounds with therapeutic applications. |
| | 5-Benzyl-3,6-dioxo-2-piperazineacetic acid Preparation Products And Raw materials |
|