|
|
| | (R)-(+)-2-Phenylglycinol Basic information |
| | (R)-(+)-2-Phenylglycinol Chemical Properties |
| Melting point | 59-65 °C(lit.) | | alpha | -43 º (c=2%, EtOH) | | Boiling point | 160°C/17mm | | density | 1.104±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C, protect from light | | pka | 12.04±0.35(Predicted) | | form | powder to crystal | | color | White to Yellow to Orange | | Optical Rotation | [α]22/D 39°, c = 2 in ethanol | | Sensitive | Air Sensitive | | BRN | 3196196 | | InChI | InChI=1/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2/t8-/s3 | | InChIKey | ULSIYEODSMZIPX-SBYBRXNCNA-N | | SMILES | C1(=CC=CC=C1)[C@@H](O)CN |&1:6,r| | | CAS DataBase Reference | 2549-14-6(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3259 8/PG 3 | | WGK Germany | 3 | | F | 3-10-23-34 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29062990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| | (R)-(+)-2-Phenylglycinol Usage And Synthesis |
| Chemical Properties | Light yellow powder |
| | (R)-(+)-2-Phenylglycinol Preparation Products And Raw materials |
|