|
|
| | Oxythiamine chloride hydrochloride Basic information |
| Product Name: | Oxythiamine chloride hydrochloride | | Synonyms: | 5-(2-HYDROXYETHYL)-3-(4-HYDROXY-2-METHYL-5-PYRIMIDINYLMETHYL)-4-METHYLTHIAZOLIUM CHLORIDE;5-[2-HYDROXYETHYL]-3-[4-HYDROXY-2-METHYL-5-PYRIMIDINYLMETHYL]-4-METHYLTHIAZOLIUM CHLORIDE HYDROCHLORIDE;Oxametholone Hydrochloride;hydroxythiaminechloridehydrochloride;hyl)-4-methyl-,chloride,monohydrochloride;OXYTHIAMINE CHLORIDE HYDROCHLORIDE;OXYTHIAMINE HCL;OXYTHIAMINE CHLORIDE HCL CRYSTALLINE | | CAS: | 614-05-1 | | MF: | C12H17Cl2N3O2S | | MW: | 338.25 | | EINECS: | | | Product Categories: | Biochemistry;Vitamin Derivatives;Vitamins | | Mol File: | 614-05-1.mol |  |
| | Oxythiamine chloride hydrochloride Chemical Properties |
| Melting point | >190°C (subl.) | | storage temp. | -20°C | | solubility | DMSO (Slightly, Heated), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C12H16N3O2S.2ClH/c1-8-11(3-4-16)18-7-15(8)6-10-5-13-9(2)14-12(10)17;;/h5,7,16H,3-4,6H2,1-2H3,(H,13,14,17);2*1H | | InChIKey | QHUYPZVMEJLSEB-UHFFFAOYSA-N | | SMILES | CC(N1)=NC=C(C[N+]2=CSC(CCO)=C2C)C1=O.Cl.[Cl-] |
| WGK Germany | 3 | | RTECS | XJ7034100 | | Storage Class | 11 - Combustible Solids |
| | Oxythiamine chloride hydrochloride Usage And Synthesis |
| Uses | thiamine antagonist | | Uses | Oxythiamine chloride hydrochloride is suitable for use:
- as a reference standard for calibration curve generation in liquid chromatography-tandem mass spectrometry (LC-MS/MS) for oxythiamine pyrophosphate (OTPP) quantification in red blood cells
- as a thiamine transport inhibitor in human mammary epithelial cells (HMEC) and breast cancer cell lines
- in the synthesis of oxythiamineH picrolonate salt
| | Definition | ChEBI: A hydrochloride obtained by combining oxythiamine chloride with one molar equivalent of hydrochloric acid. | | General Description | Oxythiamine is a thiamine antimetabolite and the source through diet is by consuming acidic thiamine rich foods. | | Biochem/physiol Actions | Oxythiamine (OT) is a thiamine antagonist. It is a transketolase inhibitor and is employed to study anti-metastatic mechanisms, especially those involving metalloproteinases (MMP). It significantly sensitizes human hepatocellular carcinoma cells (HCC) to sorafenib, favoring tumor suppression. | | in vivo | Oxythiamine chloride hydrochloride (100-500 mg/kg, i.p. 4 days) inhibits tumor growth in Ehrlich's ascites tumor hosting mice[2].
Oxythiamine chloride hydrochloride (250 or 500 mg/kg, daily for 5 week) inhibits tumor cell metastasis via inhibition of MMPs in mice implanted (s.c.) with LLC cells[4].
| Animal Model: | Ehrlich's ascites tumor hosting mice[2] | | Dosage: | 100-500 mg/kg | | Administration: | i.p., 4 days | | Result: | Inhibited tumor growth by 43% at 300 mg/kg and 84% at 500 mg/kg. |
|
| | Oxythiamine chloride hydrochloride Preparation Products And Raw materials |
|