|
|
| | 1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol Basic information |
| Product Name: | 1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol | | Synonyms: | DIACETONE-D-MAN;DIACETONE-D-MANNITOL;D-MANNITOL DIACETONIDE;1,2:5,6-ISOPROPYLIDENE-D-MANNITOL;1,2:5,6-bis-o-(1-methylethylidene)-d-mannitol;1,2:5,6-BIS-O-(1-METHYLETHYLIDENE)-D-MARNITOL;1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-1,2-ethanediol;1,2:5,6-Bis-O-(1-met | | CAS: | 1707-77-3 | | MF: | C12H22O6 | | MW: | 262.3 | | EINECS: | 216-954-8 | | Product Categories: | Liver Disease Series;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals;Carbohydrates;Biochemistry;Dioxanes & Dioxolanes;Dioxolanes;O-Substituted Sugars;Sugar Alcohols;Sugars;Glycon Biochem | | Mol File: | 1707-77-3.mol |  |
| | 1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol Chemical Properties |
| Melting point | 120-122 °C(lit.) | | alpha | 6 º (c=5, Chloroform) | | Boiling point | 382.0±32.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | refractive index | 6.5 ° (C=8, CHCl3) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | methanol: 100 mg/mL, clear, colorless | | pka | 12.98±0.20(Predicted) | | form | Crystalline Powder | | color | White | | Optical Rotation | [α]/D +6.0±1.0°, c = 5 in chloroform | | BRN | 83765 | | InChI | 1S/C12H22O6/c1-11(2)15-5-7(17-11)9(13)10(14)8-6-16-12(3,4)18-8/h7-10,13-14H,5-6H2,1-4H3/t7-,8-,9-,10-/m1/s1 | | InChIKey | ODYBCPSCYHAGHA-ZYUZMQFOSA-N | | SMILES | CC1(C)OC[C@@H](O1)[C@@H](O)[C@H](O)[C@H]2COC(C)(C)O2 | | CAS DataBase Reference | 1707-77-3(CAS DataBase Reference) | | NIST Chemistry Reference | D-Mannitol, 1,2:5,6-bis-o-(1-methylethylidene)-(1707-77-3) |
| | 1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Nebivolol intermediate. | | Purification Methods | Although quite soluble in H2O, it gives a purer product when crystallised from this solvent, forming needles [Baer J Am Chem Soc 67 338 1945, NMR: Curtis et al. J Chem Soc, Perkin Trans 1 1756 1977]. [Beilstein 19/11 V 589.] |
| | 1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol Preparation Products And Raw materials |
| Raw materials | D-Mannitol, 1,2:5,6-bis-O-(1-methylethylidene)-, diacetate (9CI)-->2-Methoxypropene-->Acetone-->2,2-Dimethoxypropane-->D-Mannitol | | Preparation Products | (R)-(-)-2,2-Dimethyl-1,3-dioxolane-4-methanol-->(S)-(+)-(2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE-->(S)-4-BENZYLOXYMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE-->D-Glyceraldehyde-->(S)-4,5-ISOPROPYLIDENE-2-PENTENYLBROMIDE |
|