| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
- Triisobutylsilane
-
- $1.10
-
2026-08-25
- CAS:6485-81-0
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| | Triisobutylsilane Basic information |
| | Triisobutylsilane Chemical Properties |
| Boiling point | 204-206 °C (lit.) | | density | 0.764 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.435(lit.) | | Fp | 229 °F | | Specific Gravity | 0.764 | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | BRN | 1738887 | | InChI | 1S/C12H28Si/c1-10(2)7-13(8-11(3)4)9-12(5)6/h10-13H,7-9H2,1-6H3 | | InChIKey | BORQTRQJFUNMBC-UHFFFAOYSA-N | | SMILES | CC(C)C[SiH](CC(C)C)CC(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Triisobutylsilane Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Triisobutylsilane can be used as a reagent in combination with trifluoroacetic acid (TFA) for the deprotection of the Fmoc functional group. |
| | Triisobutylsilane Preparation Products And Raw materials |
|