| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(Methyldiphenylsilyl)ethanol Basic information |
| Product Name: | 2-(Methyldiphenylsilyl)ethanol | | Synonyms: | (2-HYDROXYETHYL)DIPHENYMETHYLSILANE;2-(DIPHENYLMETHYLSILYL)ETHANOL;2-(methyldiphenylsilyl)-ethano;(2-hydroxyethyl)diphenylmethylsilane;Ethanol,2-(methyldiphenylsilyl)-;(2-Hydroxyethyl)diphenylmethylsilane, 2-(Diphenylmethylsilyl)ethanol;DK288;2-(Methyldiphenylsilyl)ethanol | | CAS: | 40438-48-0 | | MF: | C15H18OSi | | MW: | 242.39 | | EINECS: | 254-919-9 | | Product Categories: | | | Mol File: | 40438-48-0.mol |  |
| | 2-(Methyldiphenylsilyl)ethanol Chemical Properties |
| Boiling point | 152 °C/0.2 mmHg (lit.) | | density | 1.063 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.580(lit.) | | Fp | >230 °F | | pka | 14.97±0.10(Predicted) | | form | liquid | | BRN | 4428743 | | InChI | 1S/C15H18OSi/c1-17(13-12-16,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3 | | InChIKey | RYVPOJDQPLVTLT-UHFFFAOYSA-N | | SMILES | C[Si](CCO)(c1ccccc1)c2ccccc2 | | EPA Substance Registry System | Ethanol, 2-(methyldiphenylsilyl)- (40438-48-0) |
| Risk Statements | 36/37/38 | | Safety Statements | 23-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | 2-(Methyldiphenylsilyl)ethanol Usage And Synthesis |
| Uses | 2-(Methyldiphenylsilyl)ethanol (2-(Diphenylmethylsilyl)ethanol) may be used in the preparation of 2-diphenylmethylsilylethyldithiophosphorodichloridate. |
| | 2-(Methyldiphenylsilyl)ethanol Preparation Products And Raw materials |
|