|
|
| | 2-Chloronicotinyl chloride Basic information |
| | 2-Chloronicotinyl chloride Chemical Properties |
| Melting point | 39-44 °C (lit.) | | Boiling point | 96 °C | | density | 1.2942 (rough estimate) | | refractive index | 1.5680 (estimate) | | Fp | >110°C | | storage temp. | 0-10°C | | solubility | Chloroform, DMSO, Ethyl Acetate | | pka | -2.00±0.10(Predicted) | | form | Low Melting Solid | | color | White to beige-yellow | | Sensitive | Moisture Sensitive | | BRN | 119022 | | InChI | InChI=1S/C6H3Cl2NO/c7-5-4(6(8)10)2-1-3-9-5/h1-3H | | InChIKey | RXTRRIFWCJEMEL-UHFFFAOYSA-N | | SMILES | C(Cl)(C1=CC=CN=C1Cl)=O | | CAS DataBase Reference | 49609-84-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-29-34 | | Safety Statements | 22-26-30-36/37/39-45-8-27 | | RIDADR | 3096 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29333990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Chloronicotinyl chloride Usage And Synthesis |
| Chemical Properties | 2-Chloronicotinyl chloride is off-white to brown solid | | Uses | 2-Chloronicotinyl chloride is an intermediate of synergistic pesticide Boscalid. Also, used in the preparation of thieno[2.3-b]pyrrole derivatives as cannabinoid receptor agonists useful in mono- and combination therapy of disease s. | | Uses | An intermediate of synergistic pesticide Boscalid. Also, used in the preparation of thieno[2.3-b]pyrrole derivatives as cannabinoid receptor agonists useful in mono- and combination therapy of diseases. |
| | 2-Chloronicotinyl chloride Preparation Products And Raw materials |
|