| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
- TR4161
-
- $1590.00
-
2026-05-11
- CAS:21562-57-2
- Purity:
- Supply Ability: 10g
|
| | 1,11alpha,15S-trihydroxy-prost-13e-en-9-one Basic information |
| Product Name: | 1,11alpha,15S-trihydroxy-prost-13e-en-9-one | | Synonyms: | PROSTAGLANDIN E1 ALCOHOL;1-HYDROXY PROSTAGLANDIN E1;TR4161;(11α,13E,15S)-1,11,15-Trihydroxyprost-13-en-9-one;(13E,15S)-9-Oxoprosta-13-ene-1,11α,15-triol;(3R)-3β-Hydroxy-4α-[(1E,3S)-3-hydroxy-1-octenyl]-5β-(7-hydroxyheptyl)cyclopentanone;1-Decarboxy-1-hydroxymethyl-PGE1;PGE1 alcohol | | CAS: | 21562-57-2 | | MF: | C20H36O4 | | MW: | 340.5 | | EINECS: | | | Product Categories: | | | Mol File: | 21562-57-2.mol |  |
| | 1,11alpha,15S-trihydroxy-prost-13e-en-9-one Chemical Properties |
| Boiling point | 489.2±45.0 °C(Predicted) | | density | 1.077±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 25 mg/ml; DMSO: 20 mg/ml; Ethanol: 25 mg/ml; Ethanol:PBS (pH 7.2) (1:1): 1 mg/ml | | form | A crystalline solid | | pka | 13.85±0.60(Predicted) | | InChI | 1S/C20H36O4/c1-2-3-7-10-16(22)12-13-18-17(19(23)15-20(18)24)11-8-5-4-6-9-14-21/h12-13,16-18,20-22,24H,2-11,14-15H2,1H3/b13-12+/t16-,17+,18+,20+/m0/s1 | | InChIKey | CMHCOGHTKXUQKW-KOAZGICHSA-N | | SMILES | O[C@@H](C1/C=C/[C@H](CCCCC)O)CC([C@@H]1CCCCCCCO)=O |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1,11alpha,15S-trihydroxy-prost-13e-en-9-one Usage And Synthesis |
| Uses | Prostaglandin E1 alcohol (compound 89) is a prostaglandin analog[1]. | | Definition | ChEBI: PGE1 alcohol is an aliphatic alcohol. | | References | [1] Cheolhwan Yoon, et al. Prostaglandin analogs and uses thereof. US20210139435A1. |
| | 1,11alpha,15S-trihydroxy-prost-13e-en-9-one Preparation Products And Raw materials |
|