| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
4-Amino-3-chloro-5-nitrobenzotrifluoride manufacturers
|
| | 4-Amino-3-chloro-5-nitrobenzotrifluoride Basic information |
| | 4-Amino-3-chloro-5-nitrobenzotrifluoride Chemical Properties |
| Melting point | 65-69 °C | | density | 1.5744 (estimate) | | storage temp. | 2-8°C, protect from light | | form | solid | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C7H4ClF3N2O2/c8-4-1-3(7(9,10)11)2-5(6(4)12)13(14)15/h1-2H,12H2 | | InChIKey | JLWRJMVXRUKFPA-UHFFFAOYSA-N | | SMILES | Nc1c(Cl)cc(cc1[N+]([O-])=O)C(F)(F)F | | CAS DataBase Reference | 57729-79-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-36/37/39 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 29214200 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Amino-3-chloro-5-nitrobenzotrifluoride Usage And Synthesis |
| Chemical Properties | yellow to orange-brown crystalline powder | | Uses | 4-Amino-3-chloro-5-nitrobenzotrifluoride is used in preparation of 2,6-dichloro-4-trifluoromethylphenylamine. |
| | 4-Amino-3-chloro-5-nitrobenzotrifluoride Preparation Products And Raw materials |
|