|
|
| | Oleylammonium Iodide Basic information |
| | Oleylammonium Iodide Chemical Properties |
| InChI | InChI=1S/C18H37N.HI/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;/h9-10H,2-8,11-19H2,1H3;1H/b10-9-; | | InChIKey | YXTZAIASMCAKDN-KVVVOXFISA-N | | SMILES | C(/CCCCCCCCN)=C/CCCCCCCC.I |
| | Oleylammonium Iodide Usage And Synthesis |
| Application |
Oleylamine iodine can be used to prepare different types of perovskites, such as organic perovskites, inorganic perovskites, etc., and has a wide range of applications in the optoelectronic field.
| | Advantages |
Oleylammonium Iodide has the advantages for:
better photothermal stabilit;
Improve photoelectric conversion efficiency;
Significantly improve the conversion efficiency of perovskite films.
|
| | Oleylammonium Iodide Preparation Products And Raw materials |
|