| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | (R)-(+)-8-Hydroxy-dpat hydrobromide Basic information |
| Product Name: | (R)-(+)-8-Hydroxy-dpat hydrobromide | | Synonyms: | R(+)-8-HYDROXY-DPAT HYDROBROMIDE FULL 5- HT1A SEROTONIN;(R)-(+)-2-Dipropylamino-8-hydroxy-1,2,3,4-tetrahydronaphthalene hydrobromide, (R)-(+)-8-Hydroxy-2-(dipropylamino)tetralin hydrobromide;(R)-(+)-8-Hydroxy-2-(dipropylamino)tetralin hydrobromide;Hydroxy-DPAT hydrobromide, (R)-(+)-8-;(R) (+) 8 Hydroxy DPAT hydrobromide,(R)(+)8HydroxyDPAT hydrobromide;(R)-(+)-8-Hydroxy-DPAT hydrobromide (8-Hydroxy DPAT), 5-HT1A receptor agonist;R(+)-8-OH-DPAT hydrobromide;(R)-(+)-8-Hydroxy-DPAT hydrobromide | | CAS: | 78095-19-9 | | MF: | C16H25NO.BrH | | MW: | 328.291 | | EINECS: | | | Product Categories: | | | Mol File: | 78095-19-9.mol |  |
| | (R)-(+)-8-Hydroxy-dpat hydrobromide Chemical Properties |
| storage temp. | protect from light | | solubility | H2O: >10mg/mL at ±60°C (with sonication) | | form | solid | | color | white to off-white | | Optical Rotation | [α]25/D +68.2°, c = 1 in methanol(lit.) | | Water Solubility | H2O: >10mg/mL at±60°C (with sonication) | | InChI | 1S/C16H25NO.BrH/c1-3-10-17(11-4-2)14-9-8-13-6-5-7-16(18)15(13)12-14;/h5-7,14,18H,3-4,8-12H2,1-2H3;1H/t14-;/m1./s1 | | InChIKey | BATPBOZTBNNDLN-PFEQFJNWSA-N | | SMILES | Br.CCCN(CCC)[C@@H]1CCc2cccc(O)c2C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-(+)-8-Hydroxy-dpat hydrobromide Usage And Synthesis |
| Uses | (R)-(+)-8-Hydroxy-DPAT hydrobromide has been used as a 5-HT1A agonist:
- in mice to test the activity of the serotonin receptor
- to test its effect on zebrafish melanocyte migration and survival
- to stimulate hippocampal neurons
| | Biochem/physiol Actions | (R)-(+)-8-Hydroxy-DPAT administration reduces aggressive behavior. It decreases food intake by modifying the sensitivity of 5-HT1A receptor during food deprivation. | | in vivo | R(+)-8-OH-DPAT hydrobromide (0.05 mg/kg; s.c.) potentiates SUL (HY-B1059) (10 and 25 mg/kg)-induced dopamine (DA) release in the medial prefrontal cortex (mPFC)[1]. | Animal Model: | 250-350 g, Male Sprague-Dawley albino rats[1] | | Dosage: | 0.05 mg/kg | | Administration: | S.c.; 30 min before SUL | | Result: | Potentiated SUL (HY-B1059) (10 and 25 mg/kg)-induced dopamine (DA) release in the medial prefrontal cortex (mPFC). |
| | IC 50 | 5-HT1A Receptor | | storage | Desiccate at +4°C |
| | (R)-(+)-8-Hydroxy-dpat hydrobromide Preparation Products And Raw materials |
|