| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | L-Tryptophan benzyl ester 98 Basic information |
| | L-Tryptophan benzyl ester 98 Chemical Properties |
| Melting point | 77-80 °C (lit.) | | Boiling point | 489.9±35.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 17.01±0.30(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +9.9°, c = 1 in ethanol | | Major Application | peptide synthesis | | InChI | 1S/C18H18N2O2/c19-16(18(21)22-12-13-6-2-1-3-7-13)10-14-11-20-17-9-5-4-8-15(14)17/h1-9,11,16,20H,10,12,19H2/t16-/m0/s1 | | InChIKey | TYQYRKDGHAPZRF-INIZCTEOSA-N | | SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc3ccccc3 |
| WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | L-Tryptophan benzyl ester 98 Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-Tryptophan benzyl ester 98 Preparation Products And Raw materials |
|