|
|
| | 4-NITRO-2-(TRIFLUOROMETHYL)BENZOIC ACID Basic information | | Uses |
| | 4-NITRO-2-(TRIFLUOROMETHYL)BENZOIC ACID Chemical Properties |
| Melting point | 138-142 °C (lit.) | | Boiling point | 321.4±42.0 °C(Predicted) | | density | 1.596±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 2.40±0.32(Predicted) | | color | White to off-white | | InChI | 1S/C8H4F3NO4/c9-8(10,11)6-3-4(12(15)16)1-2-5(6)7(13)14/h1-3H,(H,13,14) | | InChIKey | BPCKZQCTLCTDST-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(cc1C(F)(F)F)[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 4-NITRO-2-(TRIFLUOROMETHYL)BENZOIC ACID Usage And Synthesis |
| Uses | 4-Nitro-2-(trifluoromethyl)benzoic acid is a carboxylic acid derivative, mainly used as a pharmaceutical and pesticide intermediate. | | Chemical Properties | white to light yellow crystal powder | | Synthesis | A mixture of 2-trifluoromethylbenzoic acid (1 eq.) and concentrated sulfuric acid (22 eq.) was placed in a mechanical stirrer under nitrogen protection and cooled to 0-5 °C in an ice bath. Subsequently, fuming nitric acid (9.8 eq.) was slowly added dropwise at the same temperature for 60 minutes. After completion of the dropwise addition, the ice bath was removed and the reaction mixture was allowed to continue stirring at room temperature for 120 minutes. Upon completion of the reaction, the mixture was slowly poured into ice water and stirred at room temperature for 60 minutes. The suspension was collected by filtration and washed with cold water to give the crude 4-nitro-2-trifluoromethylbenzoic acid. To remove the regional isomers, the crude product was recrystallized from water to give the final pure product in 45% yield. The melting point range was 137-142°C. | | References | [1] Patent: WO2015/186137, 2015, A1. Location in patent: Page/Page column 17; 18 [2] J. Gen. Chem. USSR (Engl. Transl.), 1963, vol. 33, p. 2957 - 2960 [3] Zhurnal Obshchei Khimii, 1963, vol. 33, # 9, p. 3031 - 3035 [4] Patent: WO2005/51366, 2005, A2. Location in patent: Page/Page column 61 |
| | 4-NITRO-2-(TRIFLUOROMETHYL)BENZOIC ACID Preparation Products And Raw materials |
|