|
|
| | 1,3,6-TRI-O-GALLOYL-B-D-GLUCOSE Basic information |
| Product Name: | 1,3,6-TRI-O-GALLOYL-B-D-GLUCOSE | | Synonyms: | 1,3,6-TRI-O-GALLOYL-B-D-GLUCOSE;GALLOYL-B-D-GLUCOSE, 1,3,6-TRI-O-(SH);1,3,6-Tri-O-galloyl-beta-D-glucopyranose;1,3,6-Tri-O-galloyl-beta-D-glucose;beta-D-Glucopyranose 1,3,6-trigallate;NSC 69861;1,3,6-Tri-O-galloyl glucose;1,3,6-Trigalloylglucose | | CAS: | 18483-17-5 | | MF: | C27H24O18 | | MW: | 636.47 | | EINECS: | | | Product Categories: | | | Mol File: | 18483-17-5.mol |  |
| | 1,3,6-TRI-O-GALLOYL-B-D-GLUCOSE Chemical Properties |
| Melting point | 167℃ | | Boiling point | 1103.6±65.0 °C(Predicted) | | density | 1.98 | | storage temp. | -20°C | | form | Solid | | pka | 8.37±0.15(Predicted) | | color | White to off-white | | BRN | 76215 | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | RNKMOGIPOMVCHO-SJMVAQJGSA-N | | SMILES | O=C(C1=CC(O)=C(O)C(O)=C1)O[C@H]2[C@H](O)[C@@H](OC(C3=CC(O)=C(O)C(O)=C3)=O)[C@H](O)[C@@H](COC(C4=CC(O)=C(O)C(O)=C4)=O)O2 |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,3,6-TRI-O-GALLOYL-B-D-GLUCOSE Usage And Synthesis |
| Uses | 1,3,6-Trigalloylglucose is a tannin obtained from Picrorhiza kurroa seeds which exhibit lipid peroxidation and cyclooxygenase inhibitory activity. | | Definition | ChEBI: Gallotannin is a class of hydrolysable tannins obtained by condensation of the carboxy group of gallic acid (and its polymeric derivatives) with the hydroxy groups of a monosaccharide (most commonly glucose). It is functionally related to a gallic acid. |
| | 1,3,6-TRI-O-GALLOYL-B-D-GLUCOSE Preparation Products And Raw materials |
|