|
|
| | D-Glucose-6-phosphate disodium salt Basic information |
| Product Name: | D-Glucose-6-phosphate disodium salt | | Synonyms: | D-GLUCOSE 6-PHOSPHATE DISODIUM*HYDRATE S IGMA GRADE;G-6-P-Na2 salt, Robison ester disodium salt;D-GLUCOSE-6-PHOSPHATE DISODIUM SALT extrapure;D-Glucose 6-phosphate dihydrate disodium;D-Glucose 6-phosphate hydrate disodium salt;D-Glucose 6-phosphoric acid disodium salt;D-Glucose 6-Phosphate Disodium Salt Hydrate(G-6-P;disodium [(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-keto-hexyl] phosphate | | CAS: | 3671-99-6 | | MF: | C6H14NaO9P | | MW: | 284.13 | | EINECS: | 222-938-1 | | Product Categories: | substrate | | Mol File: | 3671-99-6.mol |  |
| | D-Glucose-6-phosphate disodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 0.1 g/mL, clear, colorless | | form | Powder | | color | White to Off-white | | Water Solubility | Soluble in water | | BRN | 5199009 | | InChI | InChI=1/C6H13O9P.Na.H/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;;/h1,3-6,8-11H,2H2,(H2,12,13,14);;/t3-,4+,5+,6+;;/s3 | | InChIKey | CHIBNKGHYAQTQY-DUMCKRSRSA-L | | SMILES | [C@@H](O)([C@H](O)COP(O)(O)=O)[C@H](O)[C@@H](O)C=O.[NaH] |&1:0,2,10,12,r| | | CAS DataBase Reference | 3671-99-6(CAS DataBase Reference) | | EPA Substance Registry System | D-Glucose, 6-(dihydrogen phosphate), disodium salt (3671-99-6) |
| | D-Glucose-6-phosphate disodium salt Usage And Synthesis |
| Chemical Properties | White powder | | Uses | An inhibitor of HXK (hexokinase). | | Definition |
D-Glucose 6-phosphate disodium salt is the disodium salt form of D-Glucose 6-phosphate, a common form of glucose within the cell, participating in two major metabolic pathways: glycolysis and the pentose phosphate pathway. It can be coverted to glycogen or starch for storage.
|
| | D-Glucose-6-phosphate disodium salt Preparation Products And Raw materials |
|