|
|
| | 4-Mercaptobutyric acid Basic information |
| | 4-Mercaptobutyric acid Chemical Properties |
| Melting point | 108-110 °C | | Boiling point | 128-129°C @11mm | | density | 1.1630 g/cm3 | | solubility | Chloroform | | pka | 4.65±0.10(Predicted) | | form | Oil | | color | Clear Colourless | | InChI | InChI=1S/C4H8O2S/c5-4(6)2-1-3-7/h7H,1-3H2,(H,5,6) | | InChIKey | DTRIDVOOPAQEEL-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCS | | EPA Substance Registry System | 4-Mercaptobutyric acid (13095-73-3) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | RIDADR | UN 3334 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 | | Toxicity | LD50 intraperitoneal in mouse: 135mg/kg |
| | 4-Mercaptobutyric acid Usage And Synthesis |
| Chemical Properties | Liquid | | Uses | 4-Mercaptobutyric Acid is a useful synthetic intermediate. Acyclic, Alkanes, Building Blocks, Chemical Synthesis, Organic Building Blocks. | | Definition | ChEBI: 4-sulfanylbutanoic acid is a monocarboxylic acid that is butyric acid in which one of the hydrogens at position 4 has been replaced by a thiol group. It is a thiol and a monocarboxylic acid. It is a conjugate acid of a 4-sulfanylbutanoate. |
| | 4-Mercaptobutyric acid Preparation Products And Raw materials |
|