| Company Name: |
Entegris, Inc. Gold |
| Tel: |
021-52980362 18121213678 |
| Email: |
jenny.ji@entegris.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| Product Name: | BTPP | | Synonyms: | PHOSPHAZENE BASE P1-T-BU-TRIS(TETRAMETHYLENE);LABOTEST-BB LT00847568;BTPP;tert-Butylimino-tri(pyrrolidino)phosphorane, BTPP;2-Methyl-N-(tri(pyrrolidin-1-yl)phosphoranylidene)-propan-2-amine;Phosphazene base P1-t-Bu-tris(tetraMethylene) >=97.0% (NT);(tert-Butylimino) tris(pyrrolidino)phosphane;2-Methyl-N-(tri(pyrrolidin-1-yl) | | CAS: | 161118-67-8 | | MF: | C16H33N4P | | MW: | 312.43 | | EINECS: | | | Product Categories: | | | Mol File: | 161118-67-8.mol |  |
| Melting point | −24 °C(lit.) | | Boiling point | 119-122 °C0.1 mm Hg(lit.) | | density | 1.022 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.509 | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | BRN | 9100965 | | InChI | InChI=1S/C16H33N4P/c1-16(2,3)17-21(18-10-4-5-11-18,19-12-6-7-13-19)20-14-8-9-15-20/h4-15H2,1-3H3 | | InChIKey | PVNUIRUAPVSSOK-UHFFFAOYSA-N | | SMILES | CC(C)(N=P(N1CCCC1)(N1CCCC1)N1CCCC1)C |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3267 8/PG 2 | | WGK Germany | 3 | | F | 3-10-34 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | BTPP Preparation Products And Raw materials |
|