| Company Name: |
Suzhou Changyou Gas Co., Ltd Gold
|
| Tel: |
13915558823 |
| Email: |
changyougas@aliyun.com |
| Products Intro: |
Product Name:PROPANE-D8 CAS:2875-94-7 Package:5L;5L;5L
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Propane-d8 CAS:2875-94-7 Purity:99 atoM % D Package:1L
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Propane-d8 CAS:2875-94-7 Remarks:CS-C-02736
|
| Company Name: |
Shandong Xiya Chemical Co., Ltd.
|
| Tel: |
4009903999 13395398332 |
| Email: |
sales@xiyashiji.com |
| Products Intro: |
CAS:2875-94-7 Purity:99 atom % D Package:1L
|
|
| | PROPANE-D8 Basic information |
| Product Name: | PROPANE-D8 | | Synonyms: | PROPANE-D8;PROPANE-D8, 99 ATOM % D;Propane-D8 (gas);1,1,1,2,2,3,3,3-octadeuteriopropane;PROPANE (D8, 98%);Propane-1,1,1,2,2,3,3,3-d8;CD3CD2CD3;Propane (D?, 98%) | | CAS: | 2875-94-7 | | MF: | C3D8 | | MW: | 52.15 | | EINECS: | | | Product Categories: | Alphabetical Listings;Chemical Synthesis;Gases;Specialty Gases;Stable Isotopes;Synthetic Reagents;Alphabetical Listings;Chemical Synthesis;Compressed and Liquefied GasesStable Isotopes;GasesStable Isotopes;P;Synthetic Reagents | | Mol File: | 2875-94-7.mol |  |
| | PROPANE-D8 Chemical Properties |
| Melting point | −188 °C(lit.) | | Boiling point | −42.1 °C(lit.) | | vapor density | 1.5 (vs air) | | vapor pressure | 8.42 atm ( 21.1 °C) | | InChI | InChI=1S/C3H8/c1-3-2/h3H2,1-2H3/i1D3,2D3,3D2 | | InChIKey | ATUOYWHBWRKTHZ-AUOAYUKBSA-N | | SMILES | C([2H])([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 74-98-6 |
| | PROPANE-D8 Usage And Synthesis |
| | PROPANE-D8 Preparation Products And Raw materials |
|