|
|
| | 2-Amino-3-nitrobenzoic acid Basic information |
| | 2-Amino-3-nitrobenzoic acid Chemical Properties |
| Melting point | 207-211 °C | | Boiling point | 315.51°C (rough estimate) | | density | 1.5580 | | refractive index | 1.5880 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO, Methanol | | pka | 4.20±0.20(Predicted) | | form | Solid | | color | Yellow | | Major Application | peptide synthesis | | InChI | InChI=1S/C7H6N2O4/c8-6-4(7(10)11)2-1-3-5(6)9(12)13/h1-3H,8H2,(H,10,11) | | InChIKey | JJPIVRWTAGQTPQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC([N+]([O-])=O)=C1N | | CAS DataBase Reference | 606-18-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29224999 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Amino-3-nitrobenzoic acid Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | peptide synthesis | | Synthesis Reference(s) | The Journal of Organic Chemistry, 63, p. 6797, 1998 DOI: 10.1021/jo972158g | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 2-Amino-3-nitrobenzoic acid Preparation Products And Raw materials |
|