AC-ASP(GLU-OH)-OH manufacturers
|
| | AC-ASP(GLU-OH)-OH Basic information |
| | AC-ASP(GLU-OH)-OH Chemical Properties |
| Melting point | 113-115 °C (decomp) | | Boiling point | 775.8±60.0 °C(Predicted) | | density | 1.472±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | pka | 3.28±0.10(Predicted) | | form | powder | | color | white to faint yellow | | InChI | 1S/C11H16N2O8/c1-5(14)12-7(11(20)21)4-8(15)13-6(10(18)19)2-3-9(16)17/h6-7H,2-4H2,1H3,(H,12,14)(H,13,15)(H,16,17)(H,18,19)(H,20,21) | | InChIKey | GUCKKCMJTSNWCU-BQBZGAKWSA-N | | SMILES | CC(=O)NC(CC(=O)NC(CCC(O)=O)C(O)=O)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | AC-ASP(GLU-OH)-OH Usage And Synthesis |
| Uses | neurotransmitter; mGluR3 receptors | | Definition | ChEBI: Spaglumic acid is a peptide. | | Biological Activity | The most abundant peptide neurotransmitter in the mammalian CNS. A weak activator of NMDA receptors, and a highly selective agonist for mGlu 3 receptors. Neuroprotective under non-hydrolysing conditions in vivo . |
| | AC-ASP(GLU-OH)-OH Preparation Products And Raw materials |
|