| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Methacryloxy-2-hydroxybenzophenone Basic information |
| Product Name: | 4-Methacryloxy-2-hydroxybenzophenone | | Synonyms: | (3-hydroxy-4-phenylcarbonyl-phenyl) 2-methylprop-2-enoate;[4-(benzoyl)-3-hydroxyphenyl] 2-methylprop-2-enoate;UV 725;2-methylacrylic acid [4-(benzoyl)-3-hydroxy-phenyl] ester;2-Hydroxy-4-(methacryloyloxy)benzophenone ,99%;2-Hydroxy-4-(methacryloxy)benzophenone;Methacrylic acid 3-hydroxy-4-benzoylphenyl ester;Methacrylic acid 4-benzoyl-3-hydroxyphenyl ester | | CAS: | 2035-72-5 | | MF: | C17H14O4 | | MW: | 282.29 | | EINECS: | 218-000-6 | | Product Categories: | monomer | | Mol File: | 2035-72-5.mol |  |
| | 4-Methacryloxy-2-hydroxybenzophenone Chemical Properties |
| Melting point | 77-79°C | | Boiling point | 437.4±38.0 °C(Predicted) | | density | 1.18 | | storage temp. | 2-8°C | | form | liquid | | pka | 6.90±0.35(Predicted) | | color | clearoily | | Water Solubility | Insoluble in water. | | Sensitive | Light Sensitive | | InChI | InChI=1S/C17H14O4/c1-11(2)17(20)21-13-8-9-14(15(18)10-13)16(19)12-6-4-3-5-7-12/h3-10,18H,1H2,2H3 | | InChIKey | IMNBHNRXUAJVQE-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)(C1C=CC(=CC=1O)OC(=O)C(=C)C)=O | | CAS DataBase Reference | 2035-72-5(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36-37 | | WGK Germany | WGK 3 | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 4-Methacryloxy-2-hydroxybenzophenone Usage And Synthesis |
| Chemical Properties | Off-white to light yellow powder or crystal | | Uses | 4-Methacryloxy-2-hydroxybenzophenone is a UV absorber that can be used in ophthamic and optical applications. |
| | 4-Methacryloxy-2-hydroxybenzophenone Preparation Products And Raw materials |
|