|
|
| | 2,4,6-Trifluoroaniline Basic information |
| Product Name: | 2,4,6-Trifluoroaniline | | Synonyms: | 2-Amino-1,3,5-trifluorobenzene;Benzenamine, 2,4,6-trifluoro-;2,4,6-Trifluoroanilin;2,4,6-TRIFLUOROANILINE, 97+%;2,4,6-Trifluoroaniline,98%;2,4,6-Trifluoroanili;2,4,6-trifluoroaniune;2,4,6-TRIFLUOROANILINE | | CAS: | 363-81-5 | | MF: | C6H4F3N | | MW: | 147.1 | | EINECS: | 206-660-8 | | Product Categories: | Anilines, Aromatic Amines and Nitro Compounds;Fluorobenzene;Miscellaneous;Amines;C2 to C6;Nitrogen Compounds | | Mol File: | 363-81-5.mol |  |
| | 2,4,6-Trifluoroaniline Chemical Properties |
| Melting point | 33-37 °C (lit.) | | Boiling point | 57 °C/22 mmHg (lit.) | | density | 1.3510 (estimate) | | Fp | 136 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 1.87±0.10(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | Water Solubility | Insoluble in water. | | BRN | 2831022 | | InChI | InChI=1S/C6H4F3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 | | InChIKey | BJSVKBGQDHUBHZ-UHFFFAOYSA-N | | SMILES | C1(N)=C(F)C=C(F)C=C1F | | CAS DataBase Reference | 363-81-5(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4,6-Trifluoroaniline(363-81-5) |
| Hazard Codes | Xi,Xn,F | | Risk Statements | 36/37-41-38-21/22-11-37/38 | | Safety Statements | 26-39-36/37/39-16 | | RIDADR | UN 1325 4.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,4,6-Trifluoroaniline Usage And Synthesis |
| Chemical Properties | COLORLESS TO LIGHT GREY CRYSTALS | | Uses | 2,4,6-Trifluoroaniline was used in the synthesis of:
- 3-nitro-2,4,6 -trifluoroacetanilide
- series of N′-phenyl-N-(1- phenyl cyclopentyl)-methyl ureas
- 4-substituted 2,6-difluoro N-aryl pyridinones
| | Uses | 2,4,6-Trifluoroaniline was used in the synthesis of 3-nitro-2,4,6 -trifluoroacetanilide; eries of N-phenyl-N-(1- phenyl cyclopentyl)-methyl ureas and 4-substituted 2,6-difluoro N-aryl pyridinones. |
| | 2,4,6-Trifluoroaniline Preparation Products And Raw materials |
|