| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3,6-Trifluoroaniline Basic information |
| Product Name: | 2,3,6-Trifluoroaniline | | Synonyms: | Benzenamine, 2,3,6-trifluoro- (9CI);2,3,6-Trifluoroaniline,99%;2,3,6-Trifluoroaniline 98%;2,3,6-Trifluoroaniline98%;Benzenamine, 2,3,6-trifluoro-;2,3,6-TRIFLUOROANILINE ISO 9001：2015 REACH;2, 3, 6-trifluorobenzene;2,3,6-Trifluoroaniline | | CAS: | 67815-56-9 | | MF: | C6H4F3N | | MW: | 147.1 | | EINECS: | 620-860-6 | | Product Categories: | Fluorine series;Amines;C2 to C6;Nitrogen Compounds;HALIDE;Anilines, Aromatic Amines and Nitro Compounds | | Mol File: | 67815-56-9.mol |  |
| | 2,3,6-Trifluoroaniline Chemical Properties |
| Melting point | 215-217°C | | Boiling point | 150-151°C | | density | 1.39 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.487(lit.) | | Fp | 142 °F | | storage temp. | 2-8°C | | form | liquid | | pka | 0.80±0.10(Predicted) | | color | Colourless | | Specific Gravity | 1.390 | | BRN | 4976936 | | InChI | InChI=1S/C6H4F3N/c7-3-1-2-4(8)6(10)5(3)9/h1-2H,10H2 | | InChIKey | RGUGZPYYMOAJLO-UHFFFAOYSA-N | | SMILES | C1(N)=C(F)C=CC(F)=C1F | | CAS DataBase Reference | 67815-56-9(CAS DataBase Reference) |
| | 2,3,6-Trifluoroaniline Usage And Synthesis |
| Chemical Properties | clear orange to brown liquid | | Uses | 2,3,6-Trifluoroaniline is used in preparation of sirt6 small-molecule allosteric activators. |
| | 2,3,6-Trifluoroaniline Preparation Products And Raw materials |
|