| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Pentafluoronitrobenzene
-
- $1.00
-
2020-01-10
- CAS:880-78-4
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | Pentafluoronitrobenzene Basic information |
| Product Name: | Pentafluoronitrobenzene | | Synonyms: | pentaflurophenylacetic acid;Pentafluoronitrobenzene,98%;Pentafluoronitrobenzene 98%;1-Nitropentafluorobenzene;2,3,4,5,6-Pentafluoro-1-nitrobenzene;PENTAFLUORONITROBENZ;1-Nitro-2,3,4,5,6-pentafluorobenzene, Perfluoronitrobenzene;2,3,4,5,6-PENTAFLUORONITROBENZENE | | CAS: | 880-78-4 | | MF: | C6F5NO2 | | MW: | 213.06 | | EINECS: | 212-915-4 | | Product Categories: | Nitro Compounds;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 880-78-4.mol |  |
| | Pentafluoronitrobenzene Chemical Properties |
| Melting point | -22.65°C | | Boiling point | 158-161 °C(lit.) | | density | 1.656 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.447(lit.) | | Fp | 195 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Yellow | | InChI | 1S/C6F5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 | | InChIKey | INUOFQAJCYUOJR-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1c(F)c(F)c(F)c(F)c1F | | CAS DataBase Reference | 880-78-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29049090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Pentafluoronitrobenzene Usage And Synthesis |
| Chemical Properties | Boiling point 158℃-161℃, flash point 90℃, refractive index 1.4470, specific gravity 1.061. | | Uses | Pentafluoronitrobenzene has been used in the preparation of p-azidotetrafluoroaniline, a new photoaffinity reagent. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 60, p. 7348, 1995 DOI: 10.1021/jo00127a048 | | General Description | Electron attachment to pentafluoronitrobenzene has been studied in the energy range 0-16eV by means of a crossed electron-molecular beam experiment with mass spectrometric detection of the anions. The electroreduction of pentafluoronitrobenzene in dimethylformamide solution results in the formation of the dimer, octafluoro-4,4′-dinitro-biphenyl. |
| | Pentafluoronitrobenzene Preparation Products And Raw materials |
|