Furosemide Impurity 6 manufacturers
|
| | Furosemide Impurity 6 Basic information |
| Product Name: | Furosemide Impurity 6 | | Synonyms: | 4-chloro-2-((furan-2-ylmethyl)amino)benzoic acid;Furosemide Impurity 36;4-Chloro-2-[(2-furanylmethyl)amino]benzoic acid;Benzoic acid, 4-chloro-2-[(2-furanylmethyl)amino]-;Furosemide EP Impurity 11;Furosemide Impurity H | | CAS: | 74793-12-7 | | MF: | C12H10ClNO3 | | MW: | 251.67 | | EINECS: | | | Product Categories: | | | Mol File: | 74793-12-7.mol |  |
| | Furosemide Impurity 6 Chemical Properties |
| Boiling point | 425.0±40.0 °C(Predicted) | | density | 1.422±0.06 g/cm3(Predicted) | | pka | 3.56±0.36(Predicted) | | InChI | InChI=1S/C12H10ClNO3/c13-8-3-4-10(12(15)16)11(6-8)14-7-9-2-1-5-17-9/h1-6,14H,7H2,(H,15,16) | | InChIKey | SYXJAVQYZFWRFS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Cl)C=C1NCC1=CC=CO1 |
| | Furosemide Impurity 6 Usage And Synthesis |
| | Furosemide Impurity 6 Preparation Products And Raw materials |
|