| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
- Boc-L-Glu(OtBu)-OH
-
-
2026-03-20
- CAS:13726-84-6
- Min. Order: 1kg
- Purity: 99.0%
- Supply Ability: 1ton
- Boc-Glu(OtBu)-OH
-
- $30.00
-
2024-01-08
- CAS:13726-84-6
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 1000
|
| | N-tert-Butoxycarbonyl-L-glutamic acid gamma-tert-butyl ester Basic information |
| | N-tert-Butoxycarbonyl-L-glutamic acid gamma-tert-butyl ester Chemical Properties |
| Melting point | 102-105 °C | | Boiling point | 449.8±40.0 °C(Predicted) | | density | 1.121±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.82±0.10(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D 9.5±1°, c = 1% in methanol | | BRN | 2149791 | | Major Application | peptide synthesis | | InChI | 1S/C14H25NO6/c1-13(2,3)20-10(16)8-7-9(11(17)18)15-12(19)21-14(4,5)6/h9H,7-8H2,1-6H3,(H,15,19)(H,17,18)/t9-/m0/s1 | | InChIKey | YGSRAYJBEREVRB-VIFPVBQESA-N | | SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(O)=O | | CAS DataBase Reference | 13726-84-6(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924 19 00 | | Storage Class | 11 - Combustible Solids |
| | N-tert-Butoxycarbonyl-L-glutamic acid gamma-tert-butyl ester Usage And Synthesis |
| Chemical Properties | White powder crystal | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-tert-Butoxycarbonyl-L-glutamic acid gamma-tert-butyl ester Preparation Products And Raw materials |
|