(R)-(-)-2,2,2-Trifluoro-1-(9-anthryl)ethanol manufacturers
|
| | (R)-(-)-2,2,2-Trifluoro-1-(9-anthryl)ethanol Basic information |
| Product Name: | (R)-(-)-2,2,2-Trifluoro-1-(9-anthryl)ethanol | | Synonyms: | (R)-(-)-1-(9-ANTHRYL)-2,2,2-TRIFLUOROETHANOL;(R)-(-)-ALPHA-(TRIFLUOROMETHYL)-9-ANTHRACENEMETHANOL;R(-)-ALPHA-(TRIFLUOROMETHYL)ANTHRACENE-9-METHANOL;ALPHA-(TRIFLUOROMETHYL)-9-ANTHRACENEMETHANOL;(1R)-1-(9-anthracenyl)-2,2,2-trifluoroethanol;(minus)-2,2,2-trifluoro-1-(9-anthryl)-*ethanol;(R)-(-)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)-ET HANOL, 98+%;(R)-(-)-2,2,2-Trifluoro-1-(9-anthryl)ethanol~(R)-(-)-alpha-(Trifluoromethyl)anthracene-9-methanol | | CAS: | 53531-34-3 | | MF: | C16H11F3O | | MW: | 276.26 | | EINECS: | 258-611-5 | | Product Categories: | Analytical Chemistry;Anthracenes;e.e. / Absolute Configuration Determination (NMR);Enantiomer Excess & Absolute Configuration Determination | | Mol File: | 53531-34-3.mol |  |
| | (R)-(-)-2,2,2-Trifluoro-1-(9-anthryl)ethanol Chemical Properties |
| Melting point | 132-135 °C(lit.) | | Boiling point | 423.1±45.0 °C(Predicted) | | density | 1.2578 (estimate) | | refractive index | -30.5 ° (C=1, CHCl3) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 11.91±0.30(Predicted) | | form | powder to crystal | | color | White to Light yellow to Green | | Optical Rotation | [α]25/D 30°, c = 6.0 in chloroform | | BRN | 4695163 | | InChI | 1S/C16H11F3O/c17-16(18,19)15(20)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15,20H/t15-/m1/s1 | | InChIKey | ICZHJFWIOPYQCA-OAHLLOKOSA-N | | SMILES | O[C@H](c1c2ccccc2cc3ccccc13)C(F)(F)F | | CAS DataBase Reference | 53531-34-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | HS Code | 29062990 | | Storage Class | 11 - Combustible Solids |
| | (R)-(-)-2,2,2-Trifluoro-1-(9-anthryl)ethanol Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | These enantiomerically pure (+)- and ()-2,2,2-trifluoro-1-(9-anthryl)ethanols have been used for the NMR spectral determination of optical purity (and in some cases, absolute configuration) of a wide variety of sulfoxides, lactones, amines, sulfinate esters, oxaziridines and allenes. |
| | (R)-(-)-2,2,2-Trifluoro-1-(9-anthryl)ethanol Preparation Products And Raw materials |
|