|
|
| Product Name: | 3fluoro-3deoxyguanosine | | Synonyms: | 2-AMino-9-(3-Deoxy-3-Fluoro-beta-D-Ribofuranosyl)-9H-Purin-6-Ol;3fluoro-3deoxyguanosine;9-[3-deoxy-3-C-fluoro--D-ribofuranosyl]guanine cas:;9-[3-Deoxy-3-C-fluoro-beta-D-ribofuranosyl]guanine;9-[3-DEOXY-3-C-FLUORO-SS-D-RIBOFURANOSYL]GUANINE;Aids001160;Aids-001160;2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | | CAS: | 123402-21-1 | | MF: | C10H12FN5O4 | | MW: | 285.23 | | EINECS: | | | Product Categories: | | | Mol File: | 123402-21-1.mol |  |
| | 3fluoro-3deoxyguanosine Chemical Properties |
| Melting point | 289-291 °C | | density | 2.17±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Acetonitrile: Slightly soluble
DMSO: Soluble
Methanol: Slightly soluble
Water: Slightly soluble | | pka | 9?+-.0.20(Predicted) | | form | Solid | | InChI | InChI=1S/C10H12FN5O4/c11-4-3(1-17)20-9(6(4)18)16-2-13-5-7(16)14-10(12)15-8(5)19/h2-4,6,9,17-18H,1H2,(H3,12,14,15,19)/t3-,4-,6-,9-/m1/s1 | | InChIKey | VDOWHLFGBWKXJC-DXTOWSMRSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)[C@H](O)[C@@H]1F |
| | 3fluoro-3deoxyguanosine Usage And Synthesis |
| Physical Form | Solid | | Uses | 3'-Deoxy-3'-fluoroguanosine is a useful research chemical. | | References | [1] ANNE B. ELDRUP. Structure−Activity Relationship of Purine Ribonucleosides for Inhibition of Hepatitis C Virus RNA-Dependent RNA Polymerase[J]. Journal of Medicinal Chemistry, 2004, 47 9: 2283-2295. DOI: 10.1021/jm030424e |
| | 3fluoro-3deoxyguanosine Preparation Products And Raw materials |
|