- Lagociclovir
-
- $310.00
-
2026-05-06
- CAS:92562-88-4
- Purity: 99.74%
- Supply Ability: 10g
|
| | 2',3'-DIDEOXY-3'-FLUORO-GUANOSINE Basic information |
| Product Name: | 2',3'-DIDEOXY-3'-FLUORO-GUANOSINE | | Synonyms: | 2',3'-DIDEOXY-3'-FLUORO-GUANOSINE;3'-fluoro-2',3'-dideoxyguanosine;Lagociclovir;Guanosine, 2',3'-dideoxy-3'-fluoro-;MIV 210;Lagociclovir(MIV-210);2,3’-dideoxy-3’-fluoro guanosine, Lagociclovir;2',3'-dideoxy-3'-fluoroguanosine | | CAS: | 92562-88-4 | | MF: | C10H12FN5O3 | | MW: | 269.23 | | EINECS: | | | Product Categories: | | | Mol File: | 92562-88-4.mol |  |
| | 2',3'-DIDEOXY-3'-FLUORO-GUANOSINE Chemical Properties |
| Melting point | 253-255 °C (decomp) | | Boiling point | 633.5±65.0 °C(Predicted) | | density | 2.01±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | pka | 14.44±0.10(Predicted) | | InChI | InChI=1S/C10H12FN5O3/c11-4-1-6(19-5(4)2-17)16-3-13-7-8(16)14-10(12)15-9(7)18/h3-6,17H,1-2H2,(H3,12,14,15,18)/t4-,5+,6+/m0/s1 | | InChIKey | RTJUXLYUUDBAJN-KVQBGUIXSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)C[C@@H]1F |
| | 2',3'-DIDEOXY-3'-FLUORO-GUANOSINE Usage And Synthesis |
| Uses | Lagociclovir (FLG) is a nucleoside analogue that inhibits wild-type hepatitis B virus (HBV) replication in a human hepatoma cell line permanently expressing HBV[1]. | | References | [1] Jacquard AC, et al. In vitro characterization of the anti-hepatitis B virus activity and cross-resistance profile of 2',3'-dideoxy-3'-fluoroguanosine. Antimicrob Agents Chemother. 2006 Mar;50(3):955-61. DOI:10.1128/AAC.50.3.955-961.2006 |
| | 2',3'-DIDEOXY-3'-FLUORO-GUANOSINE Preparation Products And Raw materials |
|