| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2,5-Bis(trifluoromethyl)benzenesulfonyl chloride Basic information |
| Product Name: | 2,5-Bis(trifluoromethyl)benzenesulfonyl chloride | | Synonyms: | TRANS-(1R,2R)-N,N''-DIMETHYL-1,2-CYCLOHEXANEDIAMINE;2,5-Bis(trifluoromethyl)benzenesulfonyl chloride 97%;2,5-bis(trifluoroMethyl)benzene-1-sulfonyl chlori;2,5-bis(trifluoroMethyl)benzene-1-sulfonyl chloride;Benzenesulfonyl chloride, 2,5-bis(trifluoromethyl)-;2,5-BIS(TRIFLUOROMETHYL)BENZENESULPHONYL CHLORIDE;2,5-Bis(trifluoromethyl)benzenesulfonyl chloride | | CAS: | 351003-22-0 | | MF: | C8H3ClF6O2S | | MW: | 312.62 | | EINECS: | 624-444-5 | | Product Categories: | Organic Building Blocks;Sulfonyl Halides;Sulfur Compounds | | Mol File: | 351003-22-0.mol |  |
| | 2,5-Bis(trifluoromethyl)benzenesulfonyl chloride Chemical Properties |
| Melting point | 59-63 °C (lit.) | | Boiling point | 277.6±40.0 °C(Predicted) | | density | 1.618±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | crystalline solid | | color | White | | Sensitive | Hygroscopic | | InChI | 1S/C8H3ClF6O2S/c9-18(16,17)6-3-4(7(10,11)12)1-2-5(6)8(13,14)15/h1-3H | | InChIKey | KMEJLLXSUGLEDJ-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(c(c1)S(Cl)(=O)=O)C(F)(F)F | | CAS DataBase Reference | 351003-22-0(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Hygroscopic | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2904990090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,5-Bis(trifluoromethyl)benzenesulfonyl chloride Usage And Synthesis |
| | 2,5-Bis(trifluoromethyl)benzenesulfonyl chloride Preparation Products And Raw materials |
|