|
|
| | 24-norursodeoxycholic acid Basic information |
| Product Name: | 24-norursodeoxycholic acid | | Synonyms: | 24-norursodeoxycholic acid;(3α,5β,7β)-3,7-Dihydroxy-24-norcholan-23-oic Acid;3α,7β-Dihydroxy-24-nor-5β-cholan-23-oic Acid;Urosodeoxycholic Acid Impurity 24;24-Norursodeoxycholic acid,24Norursodeoxycholic acid,Inhibitor,Norucholic acid,24 Norursodeoxycholic acid,inhibit;24-Norcholan-23-oic acid, 3,7-dihydroxy-, (3α,5β,7β)-;(R)-3-[(3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-Dihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic Acid;24-Norursodeoxycholic acid, 10 mM in DMSO | | CAS: | 99697-24-2 | | MF: | C23H38O4 | | MW: | 378.55 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Steroids | | Mol File: | 99697-24-2.mol |  |
| | 24-norursodeoxycholic acid Chemical Properties |
| Melting point | 117 - 123°C | | Boiling point | 536.7±25.0 °C(Predicted) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 4.71±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | InChIKey | QYYDXDSPYPOWRO-JHMCBHKWSA-N | | SMILES | O[C@@H]1[C@@H]2[C@@H]([C@@]4([C@H](C1)C[C@@H](CC4)O)C)CC[C@]3([C@H]2CC[C@@H]3[C@@H](CC(=O)O)C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 24-norursodeoxycholic acid Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | Ursodeoxycholic Acid (U850000) derivative. 24-norUrsodeoxycholic acid is superior to Ursodeoxycholic acid in the treatment of sclerosing cholangitis in Mdr2 (Abcb4) knockout mice. | | Biological Activity | Orally active bile acid, side chain-shortened ursodeoxycholic acid (UDCA) homologue with in vivo efficacy in cholestatic and fibrotic liver disease models. |
| | 24-norursodeoxycholic acid Preparation Products And Raw materials |
|