- Euscaphic acid
-
- $73.00
-
2026-07-27
- CAS:53155-25-2
- Purity: 99.55%
- Supply Ability: 10g
- euscaphic acid
-
- $1.00
-
2020-01-05
- CAS: 53155-25-2
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | euscaphic acid Basic information |
| Product Name: | euscaphic acid | | Synonyms: | euscaphic acid;Acuminatic acid;Euscapic acid;Euscophic acid;Jacarandic acid;euscaphicaci;Urs-12-en-28-oic acid,2,3,19-trihydroxy-, (2a,3a)-;Urs-12-en-28-oic acid, 2,3,19-trihydroxy-, (2α,3α)- | | CAS: | 53155-25-2 | | MF: | C30H48O5 | | MW: | 488.7 | | EINECS: | 200-258-5 | | Product Categories: | Triterpenoids | | Mol File: | 53155-25-2.mol |  |
| | euscaphic acid Chemical Properties |
| Melting point | 262-264 °C(Solv: chloroform (67-66-3); methanol (67-56-1)) | | Boiling point | 602.7±55.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Methanol (Slightly), Pyridine (Slightly) | | form | Solid | | pka | 4.47±0.70(Predicted) | | color | White to Off-White | | InChIKey | OXVUXGFZHDKYLS-SPQMEPECSA-N | | SMILES | C[C@H]1[C@](O)(C)[C@H]2[C@@](C(=O)O)(CC[C@]3([C@@]4(C)[C@@H]([C@@]5(C(CC4)C(C)(C)[C@H](O)[C@H](O)C5)C)CC=C32)C)CC1 |
| Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | euscaphic acid Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, DMSO, etc., derived from the roots of golden cherry and the seeds of Fujian wild jasmine. | | Uses | Euscaphic Acid is a hypoglycemic natural product from Folium Eriobotryae with anti-inflammatory properties. Euscaphic Acid also downregulates NF-κB activations and inhibits LPS-induced inflammatory responses. | | Definition | ChEBI: Euscaphic acid is a pentacyclic triterpenoid that is urs-12-en-28-oic acid substituted by hydroxy groups at positions 2, 3 and 19 respectively (the 2alpha,3alpha-stereoisomer). It has been isolated from the leaves of Rosa laevigata. It has a role as a plant metabolite. It is a pentacyclic triterpenoid, a hydroxy monocarboxylic acid and a triol. It derives from a hydride of an ursane. | | target | LDL | NO | PGE | TNF-α | NOS | COX | NF-kB | JNK | ERK | p38MAPK | Calcium Channel | Sodium Channel | ATPase | Potassium Channel | IkB | IKK |
| | euscaphic acid Preparation Products And Raw materials |
|