|
|
| | TANTALUM(V) BUTOXIDE Basic information | | Uses |
| | TANTALUM(V) BUTOXIDE Chemical Properties |
| Boiling point | 217°C 0,15mm | | density | 1.31 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.483(lit.) | | Fp | 105 °F | | form | liquid | | Specific Gravity | 1.310 | | color | colorless to light yellow | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | air sensitive, moisture sensitive | | InChI | InChI=1S/5C4H9O.Ta/c5*1-2-3-4-5;/h5*2-4H2,1H3;/q5*-1;+5 | | InChIKey | QORWLRPWMJEJKP-UHFFFAOYSA-N | | SMILES | [Ta](OCCCC)(OCCCC)(OCCCC)(OCCCC)OCCCC | | EPA Substance Registry System | 1-Butanol, tantalum(5+) salt (51094-78-1) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | TANTALUM(V) BUTOXIDE Usage And Synthesis |
| Uses |
- Precursor used for the sol-gel deposition of NaTaO3 thin films.
- Precursor used for the sol-gel deposition of Tantalum doped TiO2.
- Used for the synthesis of Tantalum oxide nanoparticles.
| | Chemical Properties | TANTALUM(V) BUTOXIDE is Clear yellow liquid | | Uses | Tantalum alkoxides are useful as starting materials for tantalum oxides for dielectrics. | | General Description | Tantalum alkoxides are useful as starting materials for tantalum oxides for dielectrics. | | reaction suitability | core: tantalum
reagent type: catalyst |
| | TANTALUM(V) BUTOXIDE Preparation Products And Raw materials |
|