| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tantalum Tris(diethylamido)-tert-butylimide Basic information |
| Product Name: | Tantalum Tris(diethylamido)-tert-butylimide | | Synonyms: | (TERT-BUTYLIMINO)TRIS(DIETHYLAMINO)TANTALUM;TRIS(DIETHYLAMIDO)(TERT-BUTYLIMIDO)TANTALUM(V);TRIS(DIETHYLAMINO)(T-BUTYLIMINO)TANTALUM;TRIS(DIETHYLAMINO)-TERT-BUTYLAMIDO TANTALUM;TRIS(DIETHYLAMINO)(TERT-BUTYLIMINO)TANTALUM(V);tert-butyliminotantalum,diethylazanide;TRIS(DIETHYLAMIDO)(TERT-BUTYLIMIDO)TANT&;TANTALUM TRIS(DIETHYLAMIDO)-TERT-BUTYLIMIDE, 99.99% (METALS | | CAS: | 169896-41-7 | | MF: | C16H39N4Ta | | MW: | 468.46 | | EINECS: | 624-910-8 | | Product Categories: | | | Mol File: | 169896-41-7.mol |  |
| | Tantalum Tris(diethylamido)-tert-butylimide Chemical Properties |
| Boiling point | 90°C/0.1mm | | density | 1.252 g/mL at 25 °C (lit.) | | Fp | 115 °F | | form | liquid | | color | colorless to pale yellow | | Specific Gravity | 1.252 | | Water Solubility | Reacts with water. | | Sensitive | Air Sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | InChI | 1S/C4H9N.3C4H10N.Ta/c1-4(2,3)5;3*1-3-5-4-2;/h1-3H3;3*3-4H2,1-2H3;/q;3*-1;+3 | | InChIKey | YYKBKTFUORICGA-UHFFFAOYSA-N | | SMILES | CCN(CC)[Ta](=NC(C)(C)C)(N(CC)CC)N(CC)CC | | CAS DataBase Reference | 169896-41-7 | | EPA Substance Registry System | Tantalum, tris(N-ethylethanaminato)[2-methyl-2-propanaminato(2-)]-, (T-4)- (169896-41-7) |
| Hazard Codes | C | | Risk Statements | 10-14/15-34 | | Safety Statements | 26-36/37/39-43-45 | | RIDADR | UN 3398 4.3/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 4.3 | | PackingGroup | II | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 2
Skin Corr. 1B
Water-react 1 |
| | Tantalum Tris(diethylamido)-tert-butylimide Usage And Synthesis |
| Uses | Tantalum tris(diethylamido)-tert-butylimide is a useful precursor for the atomic layer deposition of tantalum oxide and tantalum nitride. | | Uses | Tantalum tris(diethylamido)-tert-butylimide is used as a precursor for tantalum nitride. | | General Description | Atomic number of base material: 73 Tantalum | | reaction suitability | core: tantalum
reagent type: catalyst |
| | Tantalum Tris(diethylamido)-tert-butylimide Preparation Products And Raw materials |
|