- Piretanide
-
- $35.00
-
2026-05-11
- CAS:55837-27-9
- Purity:
- Supply Ability: 10g
- Piretanide
-
- $1.00
-
2020-01-09
- CAS:55837-27-9
- Min. Order: 1ASSAYS
- Purity: 85.0-99.8%
- Supply Ability: 20tons
|
| | Piretanide Basic information |
| | Piretanide Chemical Properties |
| Melting point | 225-227° | | Boiling point | 253°C (rough estimate) | | density | 1.3049 (rough estimate) | | refractive index | 1.6510 (estimate) | | storage temp. | 2-8°C | | solubility | Very slightly soluble in water, sparingly soluble in anhydrous ethanol. It shows polymorphism (5.9). | | pka | 10.22±0.60(Predicted) | | form | Solid | | color | Pale-yellow platelets from MeOH (aq) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H18N2O5S/c18-25(22,23)15-11-12(17(20)21)10-14(19-8-4-5-9-19)16(15)24-13-6-2-1-3-7-13/h1-3,6-7,10-11H,4-5,8-9H2,(H,20,21)(H2,18,22,23) | | InChIKey | UJEWTUDSLQGTOA-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(N)c1c(c(cc(c1)C(=O)O)N3CCCC3)Oc2ccccc2 | | CAS DataBase Reference | 55837-27-9(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 in rats, mice (mg/kg): 5601, 3672 orally (Merkel) |
| | Piretanide Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Originator | Arelix ,Hoechst, Italy ,1980 | | Uses | High-ceiling loop diuretic; structurally related to Bumetanide (B689550). Diuretic. | | Definition | ChEBI: Piretanide is an aromatic ether. | | Brand name | Arlix (Hoechst-Roussel). | | Therapeutic Function | Diuretic | | Safety Profile | Poison by intravenous route. Moderately toxic by ingestion, intraperitoneal, and subcutaneous routes. An experimental teratogen. Experimental reproductive effects. Used as a diuretic agent. When heated to decomposition it emits very toxic fumes of SOx an |
| | Piretanide Preparation Products And Raw materials |
|