|
|
| | 2-Chloro-5-(trifluoromethyl)-3-pyridinecarboxylic acid Basic information |
| Product Name: | 2-Chloro-5-(trifluoromethyl)-3-pyridinecarboxylic acid | | Synonyms: | 2-Chloro-5-(trifluoromethyl)-3-pyridinecarboxylic acid;2-Chloro-5-(trifluoromethyl)pyridine-3-carboxylic acid, 3-Carboxy-2-chloro-5-(trifluoromethyl)pyridine;3-Pyridinecarboxylic acid, 2-chloro-5-(trifluoroMethyl)-;2-Chloro-5-(trifluoromethyl)nicotinicacid,97%;2-Chloro-5-(Trifluoromethyl)-3-PyridinecarboxylicAci;2-Chloro-5-(trifluoromethyl)-3-pyridinecarboxylic acid ISO 9001：2015 REACH | | CAS: | 505084-59-3 | | MF: | C7H3ClF3NO2 | | MW: | 225.55 | | EINECS: | | | Product Categories: | Fluorine series | | Mol File: | 505084-59-3.mol |  |
| | 2-Chloro-5-(trifluoromethyl)-3-pyridinecarboxylic acid Chemical Properties |
| Melting point | 281℃ | | Boiling point | 301.5±42.0 °C(Predicted) | | density | 1.603±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 1.57±0.25(Predicted) | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H3ClF3NO2/c8-5-4(6(13)14)1-3(2-12-5)7(9,10)11/h1-2H,(H,13,14) | | InChIKey | RMSKYTKOFDQVEL-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(F)(F)F)C=C1C(O)=O |
| Hazard Codes | Xi,Xn,T | | Risk Statements | 22-36/37/38-25 | | Safety Statements | 22-26-36/37/39-45 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Chloro-5-(trifluoromethyl)-3-pyridinecarboxylic acid Usage And Synthesis |
| | 2-Chloro-5-(trifluoromethyl)-3-pyridinecarboxylic acid Preparation Products And Raw materials |
|