| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)copper(II) Basic information |
| Product Name: | Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)copper(II) | | Synonyms: | COPPER BIS(DIPIVALOYLMETHANATE);COPPER BIS(2,2,6,6-TETRAMETHYLHEPTANE-3,5-DIONE);COPPER(II) BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE);COPPER II 2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE;COPPER(II) DIPIVALOYLMETHANATE;COPPER(II)-THD;2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONE, COPPER(II) DERIVATIVE;Copper dipivaloylmethane | | CAS: | 14040-05-2 | | MF: | C22H38CuO4 | | MW: | 430.08 | | EINECS: | | | Product Categories: | Cu;metal beta-diketonate complexes | | Mol File: | 14040-05-2.mol |  |
| | Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)copper(II) Chemical Properties |
| Melting point | 198 °C (dec.)(lit.) | | Boiling point | 315 °C | | Fp | 100°C/0.1mm subl. | | storage temp. | Inert atmosphere,Room Temperature | | form | crystal | | color | blue | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/2C11H20O2.Cu/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7,12H,1-6H3;/q;;+2/p-2/b2*8-7-; | | InChIKey | TWMOCZOBPZKIRU-CFYXSCKTSA-M | | SMILES | CC(C)(C)C(=O)\C=C(/O[Cu]O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C | | CAS DataBase Reference | 14040-05-2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29141900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)copper(II) Usage And Synthesis |
| Chemical Properties | purple-blue to dark grey granules or crystals | | Uses | Di(dipivaloylmethanato)copper is used in preparation method of doped graphite-like carbon nitride material. | | General Description | Atomic number of base material: 29 Copper | | reaction suitability | core: copper |
| | Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)copper(II) Preparation Products And Raw materials |
|