|
|
| | MAHMA NONOATE Basic information |
| Product Name: | MAHMA NONOATE | | Synonyms: | MAHMA/NO;MAHMA NONOATE;METHYLAMINE HEXAMETHYLENE METHYLAMINE NONOATE;(Z)-1-[N-METHYL-N-[6-(N-METHYLAMMONIOHEXYL)AMINO]]DIAZEN-1-IUM-1,2-DIOLATE;noc-9crystalline;1-HYDROXY-2-OXO-3-(N-METHYL-6-AMINOHEXYL)-3 METHYL-1-TRIAZENE;6-(2-HYDROXY-1-METHYL-2-NITROSOHYDRAZINO)-N-METHYL-1-HEXANAMINE;NOC-9, 6-(2-Hydroxy-1-methyl-2-nitrosohydrazino)-N-methyl-1-hexanamine | | CAS: | 146724-86-9 | | MF: | C8H20N4O2 | | MW: | 204.27 | | EINECS: | | | Product Categories: | | | Mol File: | 146724-86-9.mol |  |
| | MAHMA NONOATE Chemical Properties |
| Melting point | 102-108 °C | | Boiling point | 301.7±44.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | −70°C | | solubility | Soluble in water highly | | form | White to off-white crystalline solid. | | pka | 0.45±0.69(Predicted) | | color | Off-white to light yellow | | InChI | 1S/C8H19N4O2/c1-9-7-5-3-4-6-8-11(2)12(14)10-13/h9H,3-8H2,1-2H3/q-1/p+1 | | InChIKey | WASRCWNCCFPNEJ-UHFFFAOYSA-O | | SMILES | [H][N+]([H])(C)CCCCCCN(C)N([O-])N=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29270000 | | Storage Class | 11 - Combustible Solids |
| | MAHMA NONOATE Usage And Synthesis |
| Description | MAHMA NONOate is a NO donor. It spontaneously dissociates in a pH-dependent, first-order process with a half-life of 1 minute and 3 minutes at 37°C and 22-25°C, respectively, (pH 7.4) to liberate 2 moles of NO per mole of parent compound. | | Chemical Properties | white to off-white crystalline solid | | Uses | MAHMA NONOate is a diazeniumdiolate quick-releasing NO donor. | | in vivo | MAHMA NONOate (0.3-10 nmol/kg/min; i.v. once) shows both platelet inhibitory and vasodepressor effects in vivo[2]. | Animal Model: | Male Wistar rats anaesthetised with pentobarbitone[2] | | Dosage: | 0.3-10 nmol/kg/min | | Administration: | Intravenous injection; 0.3-10 nmol/kg/min once | | Result: | Dose-dependently decreased in mean systemic artery pressure and showd a more potent effect than GSNO. Caused dose-dependent inhibition of the response to 0.3 μM/kg ADP.
|
| | References | [1] L K KEEFER. “NONOates” (1-substituted diazen-1-ium-1,2-diolates) as nitric oxide donors: convenient nitric oxide dosage forms.[J]. Methods in enzymology, 1996, 268: 281-293. DOI: 10.1016/s0076-6879(96)68030-6
[2] TENG LI. Rational Design and Bioimaging Applications of Highly Specific “Turn-On” Fluorescent Probe for Hypochlorite[J]. Bioconjugate Chemistry Bioconjugate, 2018, 29 8: 2838-2845. DOI: 10.1021/acs.bioconjchem.8b00430 |
| | MAHMA NONOATE Preparation Products And Raw materials |
|