|
|
| | (1S,2S)-(-)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-ETHANE DIAMINE Basic information |
| Product Name: | (1S,2S)-(-)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-ETHANE DIAMINE | | Synonyms: | (1S,2S)-N,N′-Dimethyl-1,2-diphenylethane-1,2-diamine;(1S,2S)-(-)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-ETHANE DIAMINE;(1S,2S)-(-)-N,N'-DIMETHYL-1,2-DIPHENYLETHYLENEDIAMINE;(1S,2S)-(-)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine,99%;(1S,2S)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethylenediamine;1,2-Ethanediamine, N,N'-dimethyl-1,2-diphenyl-, (1S,2S)-;(1S,2S)-N,N'-Dimethyl-1,2-diphenylethane-1,2-diamine;(1S,2S)-N,N'-Dimethyl-1,2-diphenylethylenediamine | | CAS: | 70749-06-3 | | MF: | C16H20N2 | | MW: | 240.34 | | EINECS: | | | Product Categories: | Chiral Compound | | Mol File: | 70749-06-3.mol |  |
| | (1S,2S)-(-)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-ETHANE DIAMINE Chemical Properties |
| Melting point | 48-51 °C | | Boiling point | 373.06°C (rough estimate) | | density | 1.0485 (rough estimate) | | refractive index | 1.5519 (estimate) | | Fp | 110℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.14±0.30(Predicted) | | form | Crystals or Crystalline Powder | | color | White to light yellow | | Optical Rotation | [α]22/D -17.0°, c =0.5 in chloroform | | InChI | 1S/C16H20N2/c1-17-15(13-9-5-3-6-10-13)16(18-2)14-11-7-4-8-12-14/h3-12,15-18H,1-2H3/t15-,16-/m0/s1 | | InChIKey | BTHYVQUNQHWNLS-HOTGVXAUSA-N | | SMILES | CN[C@H]([C@@H](NC)c1ccccc1)c2ccccc2 |
| Provider | Language |
|
ACROS
| English |
| | (1S,2S)-(-)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-ETHANE DIAMINE Usage And Synthesis |
| Chemical Properties | white to light yellow crystals or cryst. powder | | Uses | (1S,2S)-N,N′-Dimethyl-1,2-diphenyl-1,2-ethylenediamine can be used as:
- A precursor for the synthesis of chiral imidazolinium salts, which are used as catalysts for aza DielsAlder reaction and as shift reagents for potassium salt of Mosher′s acid.
- A ligand in the preparation of 2,3-dihydrobenzofurans and indanes by reacting alkyl halides with alkyl electrophiles using nickel/diamine catalyst.
- A ligand in the synthesis of carbamates, sulfonamides, and sulfones through alkyl-alkyl Suzuki reaction using Ni catalyst.
|
| | (1S,2S)-(-)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-ETHANE DIAMINE Preparation Products And Raw materials |
|