| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1S,2S)-(-)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 Basic information |
| Product Name: | (1S,2S)-(-)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 | | Synonyms: | (1S,2S)-(-)-N,N''-DIMETHYL-1,2-BIS3-(TRIFLUOROMETHYL)PHENYL-1,2-ETHANE DIAMINE 99%;(1S,2S)-(-)-N,N'-DIMETHYL-1,2-BIS3-(TRIFLUOROMETHYL)PHENYLa-1,2-ETHANE DIAMINE, 99%;(1S,2S)-()-N,N′-DiMethyl-1,2-bis[3-(trifluoroMethyl)phenyl]ethylenediaMine;(1S,2S)-(-)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethylenediamine 97%;(1S,2S)-N1,N2-dimethyl-1,2-bis(3-(trifluoromethyl)phenyl)ethane-1,2-diamine;(1R,2R)-(+)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethylenediamine;1,2-Ethanediamine, N1,N2-dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]-, (1S,2S)-;(1S,2S)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethane-1,2-diamine | | CAS: | 205873-26-3 | | MF: | C18H18F6N2 | | MW: | 376.34 | | EINECS: | | | Product Categories: | | | Mol File: | 205873-26-3.mol |  |
| | (1S,2S)-(-)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 Chemical Properties |
| Melting point | 113 °C | | Boiling point | 348.0±37.0 °C(Predicted) | | density | 1.2608 (estimate) | | storage temp. | 2-8°C, protect from light | | pka | 8.47±0.30(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | 1S/C18H18F6N2/c1-25-15(11-5-3-7-13(9-11)17(19,20)21)16(26-2)12-6-4-8-14(10-12)18(22,23)24/h3-10,15-16,25-26H,1-2H3/t15-,16-/m0/s1 | | InChIKey | SBGOGHODWUZHIY-HOTGVXAUSA-N | | SMILES | CN[C@H]([C@@H](NC)c1cccc(c1)C(F)(F)F)c2cccc(c2)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | (1S,2S)-(-)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 Usage And Synthesis |
| Chemical Properties | white fine needle-like crystalline powder |
| | (1S,2S)-(-)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 Preparation Products And Raw materials |
|