- 5-Acetylindole
-
- $1.00 / 1KG
-
2019-12-25
- CAS:53330-94-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: G/KG/T
|
| | 5-Acetylindole Basic information |
| Product Name: | 5-Acetylindole | | Synonyms: | 5-ACETYLINDOLE 97+%;Ethanone, 1-(1H-indol-5-yl)- (9CI);1-(1H-Indol-5-yl)ethan-1-one;Ethanone, 1-(1H-indol-5-yl)-;1-(1H-Indol-5-yl)ethan-1-one, 5-Ethanoyl-1H-indole;ketone,indol-5-ylmethyl;1-(1H-INDOL-5-YL)-ETHANONE;5-INDOLYL-METHYLKETONE | | CAS: | 53330-94-2 | | MF: | C10H9NO | | MW: | 159.18 | | EINECS: | | | Product Categories: | ACETYLGROUP;Indoles and derivatives | | Mol File: | 53330-94-2.mol |  |
| | 5-Acetylindole Chemical Properties |
| Melting point | 95-96°C | | Boiling point | 284.68°C (rough estimate) | | density | 1.1202 (rough estimate) | | refractive index | 1.5460 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 16.06±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H9NO/c1-7(12)8-2-3-10-9(6-8)4-5-11-10/h2-6,11H,1H3 | | InChIKey | GOFIUEUUROFVMA-UHFFFAOYSA-N | | SMILES | C(=O)(C1C=CC2=C(C=1)C=CN2)C | | CAS DataBase Reference | 53330-94-2(CAS DataBase Reference) |
| | 5-Acetylindole Usage And Synthesis |
| Uses | 5-Acetylindole, is a building block used in various chemical synthesis. | | Synthesis | Methyl lithium (1.6 M ether solution, 30 mL, 51.2 mmol) was added slowly and dropwise to a solution of anhydrous tetrahydrofuran (30 mL) of indole-5-carboxylic acid (2.5 g, 15.5 mmol) at 0 °C and under nitrogen protection. The reaction mixture was stirred at room temperature for 4 hours before the reaction was quenched with aqueous ammonium chloride solution and extracted with dichloromethane (3 x 50 mL). The organic layers were combined, washed with saturated brine, dried over anhydrous sodium sulfate and concentrated under reduced pressure to give 5-acetylindole (1.8 g, white solid). | | References | [1] European Journal of Medicinal Chemistry, 2019, p. 428 - 442
[2] Patent: WO2005/26175, 2005, A1. Location in patent: Page/Page column 73
[3] Patent: EP2287173, 2011, A1. Location in patent: Page/Page column 40-41 |
| | 5-Acetylindole Preparation Products And Raw materials |
|