|
|
| | BOC-7-AMINO-HEPTANOIC ACID Basic information |
| Product Name: | BOC-7-AMINO-HEPTANOIC ACID | | Synonyms: | BOC-AHEPT-OH;BOC-7-AHP-OH;BOC-7-AMINO-HEPTANOIC ACID;BOC-NH-(CH2)6-COOH;N-TERT-BUTYLOXYCARBONYL-7-AMINOHEPTANOIC ACID;7-(BOC-AMINO)ENANTHIC ACID;7-(BOC-AMINO)HEPTANOIC ACID;7-amino-2-[(2-methylpropan-2-yl)oxy-oxomethyl]heptanoic acid | | CAS: | 60142-89-4 | | MF: | C12H23NO4 | | MW: | 245.32 | | EINECS: | | | Product Categories: | Unusual amino acids | | Mol File: | 60142-89-4.mol |  |
| | BOC-7-AMINO-HEPTANOIC ACID Chemical Properties |
| Melting point | 56-60 °C | | Boiling point | 393.1±25.0 °C(Predicted) | | density | 1.050±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 4.77±0.10(Predicted) | | form | powder to crystaline | | color | White to Almost white | | BRN | 2050867 | | Major Application | peptide synthesis | | InChI | 1S/C12H23NO4/c1-12(2,3)17-11(16)13-9-7-5-4-6-8-10(14)15/h4-9H2,1-3H3,(H,13,16)(H,14,15) | | InChIKey | HJENAZQPOGVAEK-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCCCCCCC(O)=O | | CAS DataBase Reference | 60142-89-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | F | 9-21 | | HS Code | 2922.50.5000 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | BOC-7-AMINO-HEPTANOIC ACID Usage And Synthesis |
| Description | Boc-7-Aminoheptanoic acid can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applicaitons. Boc-7-Aminoheptanoic acid is an alkane chain with terminal carboxlic acid and Boc-protected amino groups. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | Uses | Boc-7-Aminoheptanoic acid can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applications. Boc-7-Aminoheptanoic acid is an alkane chain with terminal carboxlic acid and Boc-protected amino groups. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-7-AMINO-HEPTANOIC ACID Preparation Products And Raw materials |
|