|
|
| | 4,6-Di-tert-butylpyrogallol Basic information |
| Product Name: | 4,6-Di-tert-butylpyrogallol | | Synonyms: | TIMTEC-BB SBB007988;4,6-Ditert-butyl-1,2,3-benzenetriol;4,6-DI-TERT-BUTYLPYROGALLOL ---FLUFFY CRYSTALS---;4,6-DI(TERT-BUTYL)BENZENE-1,2,3-TRIOL;1,2,3-Benzenetriol, 4,6-bis(1,1-dimethylethyl)-;4,6-Di-tert-butylbenzene-1,2,3-triol;4,6-Bis(tert-butyl)benzene-1,2,3-triol;4,6-Di-tert-butylpyrogallol | | CAS: | 3934-77-8 | | MF: | C14H22O3 | | MW: | 238.32 | | EINECS: | | | Product Categories: | | | Mol File: | 3934-77-8.mol |  |
| | 4,6-Di-tert-butylpyrogallol Chemical Properties |
| Melting point | 121 °C(Solv: ligroine (8032-32-4)) | | Boiling point | 348.4±37.0 °C(Predicted) | | density | 1.092±0.06 g/cm3(Predicted) | | pka | 9.87±0.20(Predicted) | | form | solid | | InChI | 1S/C14H22O3/c1-13(2,3)8-7-9(14(4,5)6)11(16)12(17)10(8)15/h7,15-17H,1-6H3 | | InChIKey | NRVDOWRFIAEMPS-UHFFFAOYSA-N | | SMILES | CC(C1=C(O)C(O)=C(C(C(C)(C)C)=C1)O)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2915601990 | | Storage Class | 11 - Combustible Solids |
| | 4,6-Di-tert-butylpyrogallol Usage And Synthesis |
| | 4,6-Di-tert-butylpyrogallol Preparation Products And Raw materials |
|