| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,5-Di-tert-butylphenol Basic information |
| Product Name: | 3,5-Di-tert-butylphenol | | Synonyms: | 3,5-bis(1,1-dimethylethyl)-pheno;3,5-bis(1,1-dimethylethyl)phenol;Phenol, 3,5-bis(t-butyl);Phenol, 3,5-di-tert-butyl-;LABOTEST-BB LT00053483;Phenol, 3,5-bis(1,1-dimethylethyl;3,5-DI-TERT-BUTYLPHENOL 1138-52-9;C12254800 3,5-Di-tert-butylphenol | | CAS: | 1138-52-9 | | MF: | C14H22O | | MW: | 206.32 | | EINECS: | 214-513-4 | | Product Categories: | Aromatic Phenols | | Mol File: | 1138-52-9.mol |  |
| | 3,5-Di-tert-butylphenol Chemical Properties |
| Melting point | 87-89 °C(lit.) | | Boiling point | 281.58°C (estimate) | | density | 0.9389 (estimate) | | refractive index | 1.5073 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.21±0.10(Predicted) | | color | Pale Brown to Light Brown | | Stability: | Stable. Incompatible with bases, acid chlorides, acid anhydrides, oxidizing agents, brass, steel, copper, copper alloys. | | InChI | InChI=1S/C14H22O/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9,15H,1-6H3 | | InChIKey | ZDWSNKPLZUXBPE-UHFFFAOYSA-N | | SMILES | C1(O)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 | | LogP | 4.640 | | CAS DataBase Reference | 1138-52-9(CAS DataBase Reference) | | EPA Substance Registry System | 3,5-Di-tert-butylphenol (1138-52-9) |
| Hazard Codes | C | | Risk Statements | 34-41 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3077 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III |
| | 3,5-Di-tert-butylphenol Usage And Synthesis |
| Chemical Properties | off-white crystals or powder | | Uses | 3,5-Di-tert-butylphenol is an volatile organic compound with anti-biofilm and antifungal activities. 3,5-Di-tert-butylphenol induces accumulation of reactive oxygen species (ROS). | | References | [1] Janarthanam Rathna, et al. Anti-biofilm mechanisms of 3,5-di-tert-butylphenol against clinically relevant fungal pathogens. Biofouling. 2016 Oct;32(9):979-93. DOI:10.1080/08927014.2016.1216103
[2] Jian-Hua Chen, et al. Characterization of Volatile Organic Compounds Emitted from Endophytic Burkholderia cenocepacia ETR-B22 by SPME-GC-MS and Their Inhibitory Activity against Various Plant Fungal Pathogens. Molecules. 2020 Aug 19;25(17):3765. DOI:10.3390/molecules25173765 |
| | 3,5-Di-tert-butylphenol Preparation Products And Raw materials |
|