|
|
| | 3-ISOPROPYLPHENOL Basic information |
| | 3-ISOPROPYLPHENOL Chemical Properties |
| Melting point | 25 °C(lit.) | | Boiling point | 228 °C(lit.) | | density | 0.994 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.526(lit.) | | Fp | 220 °F | | storage temp. | -20°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Sparingly) | | pka | 10.03±0.10(Predicted) | | form | liquid | | color | white to brown | | Stability: | Light Sensitive | | InChI | InChI=1S/C9H12O/c1-7(2)8-4-3-5-9(10)6-8/h3-7,10H,1-2H3 | | InChIKey | VLJSLTNSFSOYQR-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(C(C)C)=C1 | | LogP | 2.851 (est) | | CAS DataBase Reference | 618-45-1(CAS DataBase Reference) | | EPA Substance Registry System | m-Isopropylphenol (618-45-1) |
| Hazard Codes | C,Xn | | Risk Statements | 22-34 | | Safety Statements | 26-28-36/37/39-45-27 | | RIDADR | UN 2430 8/PG 2 | | WGK Germany | 3 | | RTECS | SL5800000 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2907199090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Corr. 1B |
| | 3-ISOPROPYLPHENOL Usage And Synthesis |
| Chemical Properties | It is liquid at room temperature. Melting point 26°C, boiling point 228°C, refractive index 1.5261, flash point 97°C. Soluble in ether, slightly soluble in water. | | Uses | 3-Isopropylphenol is an impurity of Propofol (P829750). | | Uses | 3-Isopropylphenol (m-Isopropylphenol) may be used in the linear solvation energy relationship (LSER) studies during the characterization of stationary phases in subcritical fluid chromatography. | | General Description | 3-Isopropylphenol (3IPP), also known as m-isopropylphenol, is an alkylphenol. Its toxic impact on aquatic life has been assessed. The gasification of 3-IPP with the help of supported noble metal catalysts in supercritical water at different values of water density has been investigated. Its molar enthalpy of vaporization has been evaluated. |
| | 3-ISOPROPYLPHENOL Preparation Products And Raw materials |
|