| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2-Naphthyl benzoate manufacturers
- 2-Naphthyl benzoate
-
-
2025-12-24
- CAS:93-44-7
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
- 2-Naphthyl benzoate
-
- $1.00
-
2019-12-25
- CAS:93-44-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | 2-Naphthyl benzoate Basic information |
| | 2-Naphthyl benzoate Chemical Properties |
| Melting point | 105-109 °C | | Boiling point | 351.35°C (rough estimate) | | density | 1.1290 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Light red | | Water Solubility | insoluble | | Merck | 14,6408 | | BRN | 2052424 | | InChI | InChI=1S/C17H12O2/c18-17(14-7-2-1-3-8-14)19-16-11-10-13-6-4-5-9-15(13)12-16/h1-12H | | InChIKey | DWJIJRSTYFPKGD-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC=C1OC(=O)C1=CC=CC=C1 | | LogP | 4.223 (est) | | CAS DataBase Reference | 93-44-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 2-naphthyl ester(93-44-7) | | EPA Substance Registry System | 2-Naphthalenol, benzoate (93-44-7) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163100 | | Storage Class | 11 - Combustible Solids |
| | 2-Naphthyl benzoate Usage And Synthesis |
| Chemical Properties | LIGHT BROWN CRYSTALLINE POWDER | | Uses | 2-Naphthyl benzoate is a useful biochemical for proteomics research. It is also used as a hardening agent for paraffin. |
| | 2-Naphthyl benzoate Preparation Products And Raw materials |
|